2,3-Dihydroxycinnamic acid
 
 | 
| Names
 | 
Preferred IUPAC name
(2E)-3-(2,3-Dihydroxyphenyl)prop-2-enoic acid  
 | 
| Other names
 trans-2,3-Dihydroxycinnamate 3-(2,3-Dihydroxyphenyl)acrylic acid 
 | 
| Identifiers
 | 
| 
 | 
 | 
| 
 | 
 | 
| ChemSpider
 | 
 | 
| 
 | 
 | 
| UNII
 | 
 | 
| 
 | 
 | 
InChI=1S/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+ Key: SIUKXCMDYPYCLH-SNAWJCMRSA-N InChI=1/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)/b5-4+ Key: SIUKXCMDYPYCLH-SNAWJCMRBO  
 
 | 
c1cc(c(c(c1)O)O)/C=C/C(=O)O  
 
 | 
| Properties
 | 
| 
 | 
C9H8O4
 | 
| Molar mass
 | 
180.159 g·mol−1  
 | 
Except where otherwise noted, data are given for materials in their  standard state (at 25 °C [77 °F], 100 kPa).  
Infobox references 
 | 
2,3-Dihydroxycinnamic acid is a hydroxycinnamic acid. It is an isomer of caffeic acid.
It is a metabolite found in human urine.[1]
References
- ^ Heindl, A; Rau, O; Spiteller, G (1985). "Identification of aromatic dihydroxy acids in biological fluids". Biomedical Mass Spectrometry. 12 (2): 59–66. doi:10.1002/bms.1200120203. PMID 3158357.
 
 
 | 
|---|
| Aglycones | | Precursor |  | 
|---|
 Monohydroxycinnamic acids (Coumaric acids) |  | 
|---|
 | Dihydroxycinnamic acids |  | 
|---|
 | Trihydroxycinnamic acids |  | 
|---|
 | O-methylated forms |  | 
|---|
 | others |  | 
|---|
 
  | 
|---|
| Esters | | glycoside-likes | Esters of caffeic acid with cyclitols |  | 
|---|
 | Glycosides |  | 
|---|
 
  | 
|---|
 | Tartaric acid esters |  | 
|---|
 Other esters with caffeic acid |  | 
|---|
 Caffeoyl phenylethanoid  glycoside (CPG) | 
- Echinacoside
 
- Calceolarioside A, B, C, F
 
- Chiritoside A, B, C
 
- Cistanoside A, B, C, D, E, F, G, H
 
- Conandroside
 
- Myconoside
 
- Pauoifloside
 
- Plantainoside A
 
- Plantamajoside
 
- Tubuloside B
 
- Verbascoside (Isoverbascoside, 2′-Acetylverbascoside)
  
  | 
|---|
 
  | 
|---|
| Oligomeric forms | | Dimers | 
- Diferulic acids (DiFA) : 5,5′-Diferulic acid, 8-O-4′-Diferulic acid, 8,5′-Diferulic acid,  8,5′-DiFA (DC), 8,5′-DiFA (BF), 8,8′-Diferulic acid
  
  | 
|---|
 | Trimers |  | 
|---|
 | Tetramers |  | 
|---|
 
  | 
|---|
Conjugates with coenzyme A (CoA) |  | 
|---|