NE-CHMIMO|  | 
|
| Legal status |  | 
|---|
|
| 
[1-(Cyclohexylmethyl)-1H-indol-3-yl](naphthalen-1-yl)methanone
 | 
| CAS Number |  | 
|---|
| PubChem CID |  | 
|---|
| ChemSpider |  | 
|---|
| UNII |  | 
|---|
| CompTox Dashboard (EPA) |  | 
|---|
|
| Formula | C26H25NO | 
|---|
| Molar mass | 367.492 g·mol−1 | 
|---|
| 3D model (JSmol) |  | 
|---|
| 
O=C(c1cccc2ccccc12)c3cn(CC4CCCCC4)c5ccccc35
 | 
| 
InChI=1S/C26H25NO/c28-26(23-15-8-12-20-11-4-5-13-21(20)23)24-18-27(17-19-9-2-1-3-10-19)25-16-7-6-14-22(24)25/h4-8,11-16,18-19H,1-3,9-10,17H2Key:HGJYPIZWMHHQKS-UHFFFAOYSA-N
 | 
NE-CHMIMO (CHM-018) is an indole-based synthetic cannabinoid that is presumed to be a potent agonist of the CB1 receptor and has been sold online as a designer drug.[1][2][3] NE-CHMIMO is the 1-cyclohexylmethyl (instead of 1-pentyl) analogue of the first-generation synthetic cannabinoid JWH-018. The corresponding cyclohexylmethyl derivative of JWH-081 had also been reported several months earlier.[4]
Legal status
In the United States, all CB1 receptor agonists of the 3-(1-naphthoyl)indole class such as NE-CHMIMO are Schedule I Controlled Substances.[5]
NE-CHMIMO is a controlled substance in Japan as of November 2019.[6]
See also
References
- ^ Angerer V, Bisel P, Moosmann B, Westphal F, Auwärter V (September 2016). "Separation and structural characterization of the new synthetic cannabinoid JWH-018 cyclohexyl methyl derivative "NE-CHMIMO" using flash chromatography, GC-MS, IR and NMR spectroscopy". Forensic Science International. 266: e93 – e98. doi:10.1016/j.forsciint.2016.05.031. PMID 27297324.
- ^ Franz F, Jechle H, Angerer V, Pegoro M, Auwärter V, Neukamm MA (May 2018). "Synthetic cannabinoids in hair - Pragmatic approach for method updates, compound prevalences and concentration ranges in authentic hair samples". Analytica Chimica Acta. 1006: 61–73. doi:10.1016/j.aca.2017.12.029. PMID 30016265.
- ^ "NE-CHMIMO". New Synthetic Drugs Database.
- ^ Blakey K, Boyd S, Atkinson S, Wolf J, Slottje PM, Goodchild K, McGowan J (March 2016). "Identification of the novel synthetic cannabimimetic 8-quinolinyl 4-methyl-3-(1-piperidinylsulfonyl)benzoate (QMPSB) and other designer drugs in herbal incense". Forensic Science International. 260: 40–53. doi:10.1016/j.forsciint.2015.12.001. PMID 26795397.
- ^ 21 U.S.C. § 812: Schedules of controlled substances
- ^ "指定薬物を指定する省令が公布されました|厚生労働省". www.mhlw.go.jp (in Japanese). Ministry of Health, Labour and Welfare. Retrieved 2019-12-22.
 
|  | 
|---|
| Phytocannabinoids (comparison)
 | | Cannabibutols |  | 
|---|
 | Cannabichromenes |  | 
|---|
 | Cannabicyclols |  | 
|---|
 | Cannabidiols |  | 
|---|
 | Cannabielsoins |  | 
|---|
 | Cannabigerols |  | 
|---|
 | Cannabiphorols |  | 
|---|
 | Cannabinols | 
CBN
CBNACBN-C1CBN-C2CBN-C4CBNM
CBND
CBNP
CBVD
 | 
|---|
 | Cannabitriols |  | 
|---|
 | Cannabivarins |  | 
|---|
 | Delta-3-tetrahydrocannabinols |  | 
|---|
 | Delta-4-tetrahydrocannabinols |  | 
|---|
 | Delta-7-tetrahydrocannabinols |  | 
|---|
 | Delta-8-tetrahydrocannabinols |  | 
|---|
 | Delta-9-tetrahydrocannabinols |  | 
|---|
 | Delta-10-Tetrahydrocannabinols |  | 
|---|
 | Delta-11-Tetrahydrocannabinols |  | 
|---|
 | Miscellaneous cannabinoids |  | 
|---|
 | Active metabolites |  | 
|---|
 | 
|---|
| Endocannabinoids |  | 
|---|
| Synthetic cannabinoid
 receptor
 agonists /
 neocannabinoids
 | | Classical cannabinoids (dibenzopyrans)
 |  | 
|---|
 | Non-classical cannabinoids
 |  | 
|---|
 | Adamantoylindoles |  | 
|---|
 | Benzimidazoles |  | 
|---|
 | Benzoylindoles |  | 
|---|
 | Cyclohexylphenols |  | 
|---|
 | Eicosanoids |  | 
|---|
 | Indazole-3- carboxamides
 |  | 
|---|
 | Indole-3-carboxamides |  | 
|---|
 | Indole-3-carboxylates |  | 
|---|
 | Naphthoylindazoles |  | 
|---|
 | Naphthoylindoles |  | 
|---|
 | Naphthoylpyrroles |  | 
|---|
 | Naphthylmethylindenes |  | 
|---|
 | Naphthylmethylindoles |  | 
|---|
 | Phenylacetylindoles |  | 
|---|
 | Pyrazolecarboxamides |  | 
|---|
 | Tetramethylcyclo- propanoylindazoles
 |  | 
|---|
 | Tetramethylcyclo- propanoylindoles
 |  | 
|---|
 | Others |  | 
|---|
 | 
|---|
| Allosteric CBRTooltip Cannabinoid receptor ligands |  | 
|---|
| Endocannabinoid enhancers
 (inactivation inhibitors)
 |  | 
|---|
| Anticannabinoids (antagonists/inverse
 agonists/antibodies)
 |  | 
|---|
|  | 
|  | 
|---|
| Receptor (ligands)
 | | CB1Tooltip Cannabinoid receptor type 1 | | Agonists (abridged,
 full list)
 |  | 
|---|
 | Inverse agonists |  | 
|---|
 | Antagonists |  | 
|---|
 | 
|---|
 | CB2Tooltip Cannabinoid receptor type 2 | | Agonists | 
2-AG2-AGE (noladin ether)3,3'-Diindolylmethane4-O-Methylhonokiolα-Amyrin · β-AmyrinA-796,260A-834,735A-836,339AM-1172AM-1221AM-1235AM-1241AM-2232AnandamideAZ-11713908CannabinolCaryophylleneCB-13CBS-0550CP 55,940GW-405,833 (L-768,242)GW-842,166XHU-308JTE 7-31JWH-007JWH-015JWH-018JWH-73JWH-133L-759,633L-759,656Lenabasum (anabasum)MagnololMDA-19NabitanNADAOlorinab (APD-371)PF-03550096S-444,823SER-601Serinolamide AUR-144TedalinabTHC (dronabinol)THCVTetrahydromagnololVirodhamine
 | 
|---|
 | Antagonists |  | 
|---|
 | 
|---|
 | NAGly (GPR18)
 |  | 
|---|
 | GPR55 |  | 
|---|
 | GPR119 |  | 
|---|
 | 
|---|
| Transporter (modulators)
 | | eCBTsTooltip Endocannabinoid transporter |  | 
|---|
 | 
|---|
| Enzyme (modulators)
 | | FAAHTooltip Fatty acid amide hydrolase |  | 
|---|
 | MAGL |  | 
|---|
 | ABHD6 | 
Inhibitors: JZP-169JZP-430KT182KT185KT195KT203LEI-106ML294ML295ML296UCM710WWL-70
 | 
|---|
 | ABHD12 |  | 
|---|
 | 
|---|
| Others | 
Others: 2-PG (directly potentiates activity of 2-AG at CB1 receptor)ARN-272 (FAAH-like anandamide transporter inhibitor)
 | 
|---|
| 
See also Receptor/signaling modulators Cannabinoids (cannabinoids by structure)
 |