Lysine (data page)
| The complete data for Lysine () | ||||||||||||||||
  ![]()  | General information Chemical formula: C6H14N2O2  Molar mass: 146.19 g·mol−1 Systematic name: -2,6-Diaminohexanoic acid Abbreviations: K, Lys Synonyms: none  | |||||||||||||||
| Database data | ||||||||||||||||
| SMILES: NCCCCC(N)C(=O)O InChI=1/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/f/h9H 
  | ||||||||||||||||
| Physical properties | ||||||||||||||||
 
  | ||||||||||||||||
| Hazard properties | ||||||||||||||||
  | ||||||||||||||||
| Chemical properties | ||||||||||||||||
  | ||||||||||||||||
| Pharmacological properties | ||||||||||||||||
  This box:   
- Except where noted otherwise, data relate to Standard temperature and pressure.
 - Reliability of data general note.
 


