Chrysosplenetin
|  Chemical structure of chrysosplenetin | 
| Names | 
| IUPAC name 4′,5-Dihydroxy-3,3′,6,7-tetramethoxyflavone | 
| Systematic IUPAC name 5-Hydroxy-4-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one | 
| Other names Chrysosplenetin B3,6,7,3'-Tetra-methylquercetagetin
 Quercetagetin 3,6,7,3'-tetramethyl ether
 | 
| Identifiers | 
|  |  | 
|  |  | 
| ChemSpider |  | 
|  |  | 
| UNII |  | 
|  |  | 
| 
InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3  NKey: NBVTYGIYKCPHQN-UHFFFAOYSA-N  NInChI=1/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 Key: NBVTYGIYKCPHQN-UHFFFAOYAO
 | 
| 
O=C1c3c(O)c(OC)c(OC)cc3O/C(=C1/OC)c2ccc(O)c(OC)c2
 | 
| Properties | 
|  | C19H18O8 | 
| Molar mass | 374.345 g·mol−1 | 
| Density | 1.448 g/mL | 
| Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa).Infobox references | 
Chrysosplenetin is an O-methylated flavonol. It can be found in the root of Berneuxia thibetica and in Chamomilla recutita.[1]
References
- ^ Miroslav Repčák, Vanda Švehlı́ková, Ján Imrich, Kalevi Pihlaja (1999). "Jaceidin and chrysosplenetin chemotypes of Chamomilla recutita (L.) Rauschert". Biochemical Systematics and Ecology. 27 (7): 727–732. Bibcode:1999BioSE..27..727R. doi:10.1016/S0305-1978(98)00124-0.{{cite journal}}:  CS1 maint: multiple names: authors list (link)
 
| Flavonols and their conjugates | 
|---|
| Backbone |  | 
|---|
| Flavonols | | Aglycones |  | 
|---|
 | Conjugates | | Glycosides of herbacetin |  | 
|---|
 | Glycosides of kaempferol | 
Afzelin (Kaempferol 3-rhamnoside)Astragalin (kaempferol 3-O-glucoside)Kaempferitrin (kaempferol 3,7-dirhamnoside)Juglanin (Kaempferol 3-O-arabinoside)Kaempferol 3-alpha-L-arabinopyranosideKaempferol 3-alpha-D-arabinopyranosideKaempferol 7-alpha-L-arabinosideKaempferol 7-O-glucosideKaempferol 3-lathyrosideKaempferol 4'-rhamnosideKaempferol 5-rhamnosideKaempferol 7-rhamnosideKaempferol 7-O-alpha-L-rhamnofuranosideKaempferol 3-xylosideKaempferol 7-xylosideRobinin (kaempferol-3-O-robinoside-7-O-rhamnoside)Kaempferol 3-O-rutinosideSophoraflavonoloside (Kaempferol 3-O-sophoroside)Trifolin (Kaempferol 3-O-beta-D-galactoside)
 | 
|---|
 | Glycosides of myricetin |  | 
|---|
 | Conjugates of quercetin |  | 
|---|
 | 
|---|
 | 
|---|
| O-Methylated flavonols | | Aglycones |  | 
|---|
 | Glycosides | | of isorhamnetin | 
Narcissin (Isorhamnetin 3-O-rutinoside)Isorhamnetin 3-O-glucosideTamarixetin 7-rutinoside
 | 
|---|
 | other | 
Azalein (Azaleatin 3-O-α-L-rhamnoside)Centaurein (Centaureidin 7-O-glucoside)Eupalin (Eupalitin 3-0-rhamnoside)Eupatolin (Eupatolitin 3-O-rhamnoside)Jacein (Jaceidin 7-O-glucoside)Patulitrin (Patuletin 7-O-glucosideXanthorhamnin (Rhamnetin glycoside)
 | 
|---|
 | 
|---|
 | 
|---|
| Derivative flavonols | | Aglycones | 
NoricaritinDihydronoricaritin
 | 
|---|
 | Glycosides |  | 
|---|
 | 
|---|
| Pyranoflavonols |  | 
|---|
| Furanoflavonols |  | 
|---|
| Semisynthetic |  | 
|---|